About (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene
(9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene (PubChem CID 134928906) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene.
Molecular Properties
| Compound Name | (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene |
| PubChem CID | 134928906 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene |
| SMILES | C=CC[C@H]1C=CCC12OCCO2 |
| InChI | InChI=1S/C10H14O2/c1-2-4-9-5-3-6-10(9)11-7-8-12-10/h2-3,5,9H,1,4,6-8H2/t9-/m0/s1 |
| InChIKey | ARBJITVYJPBKRT-VIFPVBQESA-N |
| XLogP | 1.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene?
The IUPAC name of (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene (CID 134928906) is (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene.
What is the SMILES notation for (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene?
The canonical SMILES for (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene is C=CC[C@H]1C=CCC12OCCO2.
What is the InChIKey of (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene?
The InChIKey is ARBJITVYJPBKRT-VIFPVBQESA-N. The full InChI is InChI=1S/C10H14O2/c1-2-4-9-5-3-6-10(9)11-7-8-12-10/h2-3,5,9H,1,4,6-8H2/t9-/m0/s1.
What are the key properties of (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene?
(9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene has a molecular weight of 166.22 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9S)-9-prop-2-enyl-1,4-dioxaspiro[4.4]non-7-ene is sourced from PubChem (CID 134928906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).