C15H22O2 — CID 15855620
(2S,3aS,4Z,9aS)-2-ethenylspiro[1,2,3,3a,6,7,8,9a-octahydrocyclopenta[8]annulene-9,2'-1,3-dioxolane] (PubChem CID 15855620) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (2S,3aS,4Z,9aS)-2-ethenylspiro[1,2,3,3a,6,7,8,9a-octahydrocyclopenta[8]annulene-9,2'-1,3-dioxolane].
| Compound Name | (2S,3aS,4Z,9aS)-2-ethenylspiro[1,2,3,3a,6,7,8,9a-octahydrocyclopenta[8]annulene-9,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 15855620 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (2S,3aS,4Z,9aS)-2-ethenylspiro[1,2,3,3a,6,7,8,9a-octahydrocyclopenta[8]annulene-9,2'-1,3-dioxolane] |
| SMILES | C=C[C@H]1C[C@H]2/C=C\CCCC3(OCCO3)[C@H]2C1 |
| InChI | InChI=1S/C15H22O2/c1-2-12-10-13-6-4-3-5-7-15(14(13)11-12)16-8-9-17-15/h2,4,6,12-14H,1,3,5,7-11H2/b6-4-/t12-,13+,14-/m0/s1 |
| InChIKey | BMWBXXPHNLFICG-DCUPDMMRSA-N |
| XLogP | 3.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|