C19H38O2Si — CID 134931028
(3E,5S,6S,7E)-5-[tert-butyl(dimethyl)silyl]oxy-11-methyldodeca-3,7-dien-6-ol (PubChem CID 134931028) has the molecular formula C19H38O2Si and a molecular weight of 326.60 g/mol. Its IUPAC name is (3E,5S,6S,7E)-5-[tert-butyl(dimethyl)silyl]oxy-11-methyldodeca-3,7-dien-6-ol.
| Compound Name | (3E,5S,6S,7E)-5-[tert-butyl(dimethyl)silyl]oxy-11-methyldodeca-3,7-dien-6-ol |
|---|---|
| PubChem CID | 134931028 |
| Molecular Formula | C19H38O2Si |
| Molecular Weight | 326.60 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | (3E,5S,6S,7E)-5-[tert-butyl(dimethyl)silyl]oxy-11-methyldodeca-3,7-dien-6-ol |
| SMILES | CC/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/CCC(C)C |
| InChI | InChI=1S/C19H38O2Si/c1-9-10-15-18(21-22(7,8)19(4,5)6)17(20)14-12-11-13-16(2)3/h10,12,14-18,20H,9,11,13H2,1-8H3/b14-12+,15-10+/t17-,18-/m0/s1 |
| InChIKey | VPWMLAZYAFOEIR-OHTHRQAUSA-N |
| XLogP | 5.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.60 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|