C17H17N3OS — CID 134934482
2-[(2E)-2-[2-(1,3-benzothiazol-2-yl)-1-phenylethylidene]hydrazinyl]ethanol (PubChem CID 134934482) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[(2E)-2-[2-(1,3-benzothiazol-2-yl)-1-phenylethylidene]hydrazinyl]ethanol.
| Compound Name | 2-[(2E)-2-[2-(1,3-benzothiazol-2-yl)-1-phenylethylidene]hydrazinyl]ethanol |
|---|---|
| PubChem CID | 134934482 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-[(2E)-2-[2-(1,3-benzothiazol-2-yl)-1-phenylethylidene]hydrazinyl]ethanol |
| SMILES | OCCN/N=C(\Cc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C17H17N3OS/c21-11-10-18-20-15(13-6-2-1-3-7-13)12-17-19-14-8-4-5-9-16(14)22-17/h1-9,18,21H,10-12H2/b20-15+ |
| InChIKey | PBJGQHYAQLUFMU-HMMYKYKNSA-N |
| XLogP | 2.83 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|