C22H21N2O2P — CID 134934649
(Z)-3-(diphenylphosphorylamino)-3-(4-methylphenyl)prop-2-enamide (PubChem CID 134934649) has the molecular formula C22H21N2O2P and a molecular weight of 376.40 g/mol. Its IUPAC name is (Z)-3-(diphenylphosphorylamino)-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(diphenylphosphorylamino)-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 134934649 |
| Molecular Formula | C22H21N2O2P |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (Z)-3-(diphenylphosphorylamino)-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C(=C/C(N)=O)NP(=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N2O2P/c1-17-12-14-18(15-13-17)21(16-22(23)25)24-27(26,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-16H,1H3,(H2,23,25)(H,24,26)/b21-16- |
| InChIKey | PSFXONPYHZDXIC-PGMHBOJBSA-N |
| XLogP | 3.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|