ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride

C12H16ClNO2 — CID 134935954

IUPACethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride
SMILESCCOC(=O)[C@@H]1CCc2ccccc2[NH2+]1.[Cl-]
InChIInChI=1S/C12H15NO2.ClH/c1-2-15-12(14)11-8-7-9-5-3-4-6-10(9)13-11;/h3-6,11,13H,2,7-8H2,1H3;1H/t11-;/m0./s1
InChIKeyJHJIYDDFBDFQKU-MERQFXBCSA-N
MW241.72 g/mol
LogP-2.24
Rot. Bonds2

About ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride

ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride (PubChem CID 134935954) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride.

Molecular Properties

Compound Nameethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride
PubChem CID134935954
Molecular FormulaC12H16ClNO2
Molecular Weight241.72 g/mol
Exact Mass241.09
IUPAC Nameethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride
SMILESCCOC(=O)[C@@H]1CCc2ccccc2[NH2+]1.[Cl-]
InChIInChI=1S/C12H15NO2.ClH/c1-2-15-12(14)11-8-7-9-5-3-4-6-10(9)13-11;/h3-6,11,13H,2,7-8H2,1H3;1H/t11-;/m0./s1
InChIKeyJHJIYDDFBDFQKU-MERQFXBCSA-N
XLogP-2.24
TPSA42.91 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.72
LogP ≤ 5-2.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}

Analyze ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride?
The IUPAC name of ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride (CID 134935954) is ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride.
What is the SMILES notation for ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride?
The canonical SMILES for ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride is CCOC(=O)[C@@H]1CCc2ccccc2[NH2+]1.[Cl-].
What is the InChIKey of ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride?
The InChIKey is JHJIYDDFBDFQKU-MERQFXBCSA-N. The full InChI is InChI=1S/C12H15NO2.ClH/c1-2-15-12(14)11-8-7-9-5-3-4-6-10(9)13-11;/h3-6,11,13H,2,7-8H2,1H3;1H/t11-;/m0./s1.
What are the key properties of ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride?
ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride has a molecular weight of 241.72 g/mol, XLogP of -2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride is sourced from PubChem (CID 134935954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).