C12H16ClNO2 — CID 134935954
ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride (PubChem CID 134935954) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride.
| Compound Name | ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride |
|---|---|
| PubChem CID | 134935954 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | ethyl (2S)-1,2,3,4-tetrahydroquinolin-1-ium-2-carboxylate chloride |
| SMILES | CCOC(=O)[C@@H]1CCc2ccccc2[NH2+]1.[Cl-] |
| InChI | InChI=1S/C12H15NO2.ClH/c1-2-15-12(14)11-8-7-9-5-3-4-6-10(9)13-11;/h3-6,11,13H,2,7-8H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | JHJIYDDFBDFQKU-MERQFXBCSA-N |
| XLogP | -2.24 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|