C19H15ClO4 — CID 134936402
3-chloro-4-(2,5-dimethoxy-3-methylphenyl)naphthalene-1,2-dione (PubChem CID 134936402) has the molecular formula C19H15ClO4 and a molecular weight of 342.78 g/mol. Its IUPAC name is 3-chloro-4-(2,5-dimethoxy-3-methylphenyl)naphthalene-1,2-dione.
| Compound Name | 3-chloro-4-(2,5-dimethoxy-3-methylphenyl)naphthalene-1,2-dione |
|---|---|
| PubChem CID | 134936402 |
| Molecular Formula | C19H15ClO4 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 3-chloro-4-(2,5-dimethoxy-3-methylphenyl)naphthalene-1,2-dione |
| SMILES | COc1cc(C)c(OC)c(C2=C(Cl)C(=O)C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C19H15ClO4/c1-10-8-11(23-2)9-14(19(10)24-3)15-12-6-4-5-7-13(12)17(21)18(22)16(15)20/h4-9H,1-3H3 |
| InChIKey | LFEPKUQYPWYVQZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|