C19H16Cl2O4 — CID 134876806
2,3-dichloro-4-(2,5-dimethoxy-3-methylphenyl)-4-hydroxynaphthalen-1-one (PubChem CID 134876806) has the molecular formula C19H16Cl2O4 and a molecular weight of 379.24 g/mol. Its IUPAC name is 2,3-dichloro-4-(2,5-dimethoxy-3-methylphenyl)-4-hydroxynaphthalen-1-one.
| Compound Name | 2,3-dichloro-4-(2,5-dimethoxy-3-methylphenyl)-4-hydroxynaphthalen-1-one |
|---|---|
| PubChem CID | 134876806 |
| Molecular Formula | C19H16Cl2O4 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2,3-dichloro-4-(2,5-dimethoxy-3-methylphenyl)-4-hydroxynaphthalen-1-one |
| SMILES | COc1cc(C)c(OC)c(C2(O)C(Cl)=C(Cl)C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C19H16Cl2O4/c1-10-8-11(24-2)9-14(17(10)25-3)19(23)13-7-5-4-6-12(13)16(22)15(20)18(19)21/h4-9,23H,1-3H3 |
| InChIKey | BGWSTIAXPJYJMP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|