C20H22O2 — CID 134940359
(2R)-3,3-dimethyl-5-phenyl-1-phenylmethoxypent-4-yn-2-ol (PubChem CID 134940359) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-5-phenyl-1-phenylmethoxypent-4-yn-2-ol.
| Compound Name | (2R)-3,3-dimethyl-5-phenyl-1-phenylmethoxypent-4-yn-2-ol |
|---|---|
| PubChem CID | 134940359 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2R)-3,3-dimethyl-5-phenyl-1-phenylmethoxypent-4-yn-2-ol |
| SMILES | CC(C)(C#Cc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-20(2,14-13-17-9-5-3-6-10-17)19(21)16-22-15-18-11-7-4-8-12-18/h3-12,19,21H,15-16H2,1-2H3/t19-/m0/s1 |
| InChIKey | GXPOLNAMJMLQNO-IBGZPJMESA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|