C24H30O5 — CID 15336880
(2R,3S)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methyl-1-phenylmethoxypent-4-yne-2,3-diol (PubChem CID 15336880) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (2R,3S)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methyl-1-phenylmethoxypent-4-yne-2,3-diol.
| Compound Name | (2R,3S)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methyl-1-phenylmethoxypent-4-yne-2,3-diol |
|---|---|
| PubChem CID | 15336880 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (2R,3S)-5-(2,5-dimethoxy-3,4,6-trimethylphenyl)-3-methyl-1-phenylmethoxypent-4-yne-2,3-diol |
| SMILES | COc1c(C)c(C)c(OC)c(C#C[C@](C)(O)[C@H](O)COCc2ccccc2)c1C |
| InChI | InChI=1S/C24H30O5/c1-16-17(2)23(28-6)20(18(3)22(16)27-5)12-13-24(4,26)21(25)15-29-14-19-10-8-7-9-11-19/h7-11,21,25-26H,14-15H2,1-6H3/t21-,24+/m1/s1 |
| InChIKey | HFVMLWHBJWYTLY-QPPBQGQZSA-N |
| XLogP | 3.31 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|