C28H44O5S2 — CID 134942522
[(4S,6S,8R,10R)-10-hydroxy-11-[2-[(Z)-4-hydroxybut-2-enyl]-1,3-dithian-2-yl]-6-methoxy-8-methylundecan-4-yl] benzoate (PubChem CID 134942522) has the molecular formula C28H44O5S2 and a molecular weight of 524.79 g/mol. Its IUPAC name is [(4S,6S,8R,10R)-10-hydroxy-11-[2-[(Z)-4-hydroxybut-2-enyl]-1,3-dithian-2-yl]-6-methoxy-8-methylundecan-4-yl] benzoate.
| Compound Name | [(4S,6S,8R,10R)-10-hydroxy-11-[2-[(Z)-4-hydroxybut-2-enyl]-1,3-dithian-2-yl]-6-methoxy-8-methylundecan-4-yl] benzoate |
|---|---|
| PubChem CID | 134942522 |
| Molecular Formula | C28H44O5S2 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | [(4S,6S,8R,10R)-10-hydroxy-11-[2-[(Z)-4-hydroxybut-2-enyl]-1,3-dithian-2-yl]-6-methoxy-8-methylundecan-4-yl] benzoate |
| SMILES | CCC[C@@H](C[C@H](C[C@H](C)C[C@@H](O)CC1(C/C=C\CO)SCCCS1)OC)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H44O5S2/c1-4-11-25(33-27(31)23-12-6-5-7-13-23)20-26(32-3)19-22(2)18-24(30)21-28(14-8-9-15-29)34-16-10-17-35-28/h5-9,12-13,22,24-26,29-30H,4,10-11,14-21H2,1-3H3/b9-8-/t22-,24-,25+,26+/m1/s1 |
| InChIKey | RJRQLJUKVZPBKS-LQCYNQRFSA-N |
| XLogP | 6.09 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|