About 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide
4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (PubChem CID 134943857) has the molecular formula C9H15NO2S
and a molecular weight of 201.29 g/mol. Its IUPAC name is 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide.
Analyze 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide?
The IUPAC name of 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (CID 134943857) is 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide.
What is the SMILES notation for 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide?
The canonical SMILES for 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide is CN1C2CC3CCC2(C3)CS1(=O)=O.
What is the InChIKey of 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide?
The InChIKey is CYYBTHHMISPWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2S/c1-10-8-4-7-2-3-9(8,5-7)6-13(10,11)12/h7-8H,2-6H2,1H3.
What are the key properties of 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide?
4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide has a molecular weight of 201.29 g/mol, XLogP of 0.82, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide is sourced from PubChem (CID 134943857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).