C20H21FO4 — CID 134947407
ethyl (2S,4S,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxane-2-carboxylate (PubChem CID 134947407) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is ethyl (2S,4S,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxane-2-carboxylate.
| Compound Name | ethyl (2S,4S,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxane-2-carboxylate |
|---|---|
| PubChem CID | 134947407 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | ethyl (2S,4S,6R)-6-(4-fluorophenyl)-4-hydroxy-4-phenyloxane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@](O)(c2ccccc2)C[C@H](c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C20H21FO4/c1-2-24-19(22)18-13-20(23,15-6-4-3-5-7-15)12-17(25-18)14-8-10-16(21)11-9-14/h3-11,17-18,23H,2,12-13H2,1H3/t17-,18+,20+/m1/s1 |
| InChIKey | ZPIMOSCWLHJXCE-HBFSDRIKSA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |