About (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile
(2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile (PubChem CID 134948413) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile.
Molecular Properties
| Compound Name | (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile |
| PubChem CID | 134948413 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile |
| SMILES | CC(C)(C)[C@@H](C#N)N(O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-19(2,3)17(14-20)21(22)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17-18,22H,1-3H3/t17-/m1/s1 |
| InChIKey | IALFHFRBDXZOMP-QGZVFWFLSA-N |
| XLogP | 4.41 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile?
The IUPAC name of (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile (CID 134948413) is (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile.
What is the SMILES notation for (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile?
The canonical SMILES for (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile is CC(C)(C)[C@@H](C#N)N(O)C(c1ccccc1)c1ccccc1.
What is the InChIKey of (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile?
The InChIKey is IALFHFRBDXZOMP-QGZVFWFLSA-N. The full InChI is InChI=1S/C19H22N2O/c1-19(2,3)17(14-20)21(22)18(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17-18,22H,1-3H3/t17-/m1/s1.
What are the key properties of (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile?
(2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile has a molecular weight of 294.40 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[benzhydryl(hydroxy)amino]-3,3-dimethylbutanenitrile is sourced from PubChem (CID 134948413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).