C19H28INO2Si — CID 134949002
tert-butyl-[1-[3-iodo-1-(methoxymethyl)indol-2-yl]prop-2-enoxy]-dimethylsilane (PubChem CID 134949002) has the molecular formula C19H28INO2Si and a molecular weight of 457.43 g/mol. Its IUPAC name is tert-butyl-[1-[3-iodo-1-(methoxymethyl)indol-2-yl]prop-2-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[3-iodo-1-(methoxymethyl)indol-2-yl]prop-2-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134949002 |
| Molecular Formula | C19H28INO2Si |
| Molecular Weight | 457.43 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | tert-butyl-[1-[3-iodo-1-(methoxymethyl)indol-2-yl]prop-2-enoxy]-dimethylsilane |
| SMILES | C=CC(O[Si](C)(C)C(C)(C)C)c1c(I)c2ccccc2n1COC |
| InChI | InChI=1S/C19H28INO2Si/c1-8-16(23-24(6,7)19(2,3)4)18-17(20)14-11-9-10-12-15(14)21(18)13-22-5/h8-12,16H,1,13H2,2-7H3 |
| InChIKey | YVCQZOFYIAGVPH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.43 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|