C38H31N9 — CID 134954992
2,4-bis[4-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-6-methyl-1,3,5-triazine (PubChem CID 134954992) has the molecular formula C38H31N9 and a molecular weight of 613.73 g/mol. Its IUPAC name is 2,4-bis[4-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-6-methyl-1,3,5-triazine.
| Compound Name | 2,4-bis[4-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-6-methyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134954992 |
| Molecular Formula | C38H31N9 |
| Molecular Weight | 613.73 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | 2,4-bis[4-[4-(4,6-dimethyl-1,3,5-triazin-2-yl)phenyl]phenyl]-6-methyl-1,3,5-triazine |
| SMILES | Cc1nc(C)nc(-c2ccc(-c3ccc(-c4nc(C)nc(-c5ccc(-c6ccc(-c7nc(C)nc(C)n7)cc6)cc5)n4)cc3)cc2)n1 |
| InChI | InChI=1S/C38H31N9/c1-22-39-23(2)42-35(41-22)31-14-6-27(7-15-31)29-10-18-33(19-11-29)37-45-26(5)46-38(47-37)34-20-12-30(13-21-34)28-8-16-32(17-9-28)36-43-24(3)40-25(4)44-36/h6-21H,1-5H3 |
| InChIKey | PDRKHPHFIJPEAK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.73 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |