C18H16BrNO — CID 134956340
(3'R,6S)-3'-(2-bromophenyl)spiro[8,9-dihydro-7H-benzo[7]annulene-6,2'-aziridine]-5-one (PubChem CID 134956340) has the molecular formula C18H16BrNO and a molecular weight of 342.24 g/mol. Its IUPAC name is (3'R,6S)-3'-(2-bromophenyl)spiro[8,9-dihydro-7H-benzo[7]annulene-6,2'-aziridine]-5-one.
| Compound Name | (3'R,6S)-3'-(2-bromophenyl)spiro[8,9-dihydro-7H-benzo[7]annulene-6,2'-aziridine]-5-one |
|---|---|
| PubChem CID | 134956340 |
| Molecular Formula | C18H16BrNO |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (3'R,6S)-3'-(2-bromophenyl)spiro[8,9-dihydro-7H-benzo[7]annulene-6,2'-aziridine]-5-one |
| SMILES | O=C1c2ccccc2CCC[C@@]12N[C@@H]2c1ccccc1Br |
| InChI | InChI=1S/C18H16BrNO/c19-15-10-4-3-9-14(15)16-18(20-16)11-5-7-12-6-1-2-8-13(12)17(18)21/h1-4,6,8-10,16,20H,5,7,11H2/t16-,18+/m1/s1 |
| InChIKey | NTDZNWNAPUQDIG-AEFFLSMTSA-N |
| XLogP | 4.05 |
| TPSA | 39.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|