C25H31FO2 — CID 134957366
(1R,4R)-7,9-ditert-butyl-4-ethenyl-1-(4-fluorophenyl)-2-oxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 134957366) has the molecular formula C25H31FO2 and a molecular weight of 382.52 g/mol. Its IUPAC name is (1R,4R)-7,9-ditert-butyl-4-ethenyl-1-(4-fluorophenyl)-2-oxaspiro[4.5]deca-6,9-dien-8-one.
| Compound Name | (1R,4R)-7,9-ditert-butyl-4-ethenyl-1-(4-fluorophenyl)-2-oxaspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| PubChem CID | 134957366 |
| Molecular Formula | C25H31FO2 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (1R,4R)-7,9-ditert-butyl-4-ethenyl-1-(4-fluorophenyl)-2-oxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | C=C[C@H]1CO[C@H](c2ccc(F)cc2)C12C=C(C(C)(C)C)C(=O)C(C(C)(C)C)=C2 |
| InChI | InChI=1S/C25H31FO2/c1-8-17-15-28-22(16-9-11-18(26)12-10-16)25(17)13-19(23(2,3)4)21(27)20(14-25)24(5,6)7/h8-14,17,22H,1,15H2,2-7H3/t17-,22+/m0/s1 |
| InChIKey | KIMDQSLADRYHCG-HTAPYJJXSA-N |
| XLogP | 6.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|