C19H25NO7S — CID 134958016
diethyl (3aR,4R,6aS)-5-methylsulfonyl-4-phenyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate (PubChem CID 134958016) has the molecular formula C19H25NO7S and a molecular weight of 411.48 g/mol. Its IUPAC name is diethyl (3aR,4R,6aS)-5-methylsulfonyl-4-phenyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate.
| Compound Name | diethyl (3aR,4R,6aS)-5-methylsulfonyl-4-phenyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 134958016 |
| Molecular Formula | C19H25NO7S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | diethyl (3aR,4R,6aS)-5-methylsulfonyl-4-phenyl-3,3a,4,6a-tetrahydro-2H-furo[2,3-c]pyrrole-6,6-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)[C@H]2OCC[C@@H]2[C@H](c2ccccc2)N1S(C)(=O)=O |
| InChI | InChI=1S/C19H25NO7S/c1-4-25-17(21)19(18(22)26-5-2)16-14(11-12-27-16)15(20(19)28(3,23)24)13-9-7-6-8-10-13/h6-10,14-16H,4-5,11-12H2,1-3H3/t14-,15+,16+/m1/s1 |
| InChIKey | BHTBTDYHMVACIP-PMPSAXMXSA-N |
| XLogP | 1.27 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|