C23H39NO8Si — CID 134971254
(4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R,2S)-1,2-dihydroxy-3-phenylmethoxypropyl]-4-(methoxymethoxymethyl)-1,3-oxazolidin-2-one (PubChem CID 134971254) has the molecular formula C23H39NO8Si and a molecular weight of 485.65 g/mol. Its IUPAC name is (4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R,2S)-1,2-dihydroxy-3-phenylmethoxypropyl]-4-(methoxymethoxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R,2S)-1,2-dihydroxy-3-phenylmethoxypropyl]-4-(methoxymethoxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134971254 |
| Molecular Formula | C23H39NO8Si |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | (4R,5R)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1R,2S)-1,2-dihydroxy-3-phenylmethoxypropyl]-4-(methoxymethoxymethyl)-1,3-oxazolidin-2-one |
| SMILES | COCOC[C@]1(CO[Si](C)(C)C(C)(C)C)NC(=O)O[C@H]1[C@H](O)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C23H39NO8Si/c1-22(2,3)33(5,6)31-15-23(14-30-16-28-4)20(32-21(27)24-23)19(26)18(25)13-29-12-17-10-8-7-9-11-17/h7-11,18-20,25-26H,12-16H2,1-6H3,(H,24,27)/t18-,19+,20-,23+/m0/s1 |
| InChIKey | VLOKGQYIGNOUFX-FAKFISEUSA-N |
| XLogP | 2.41 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|