C21H35NO5Si — CID 162412383
benzyl N-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethyloxan-4-yl]carbamate (PubChem CID 162412383) has the molecular formula C21H35NO5Si and a molecular weight of 409.60 g/mol. Its IUPAC name is benzyl N-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethyloxan-4-yl]carbamate.
| Compound Name | benzyl N-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethyloxan-4-yl]carbamate |
|---|---|
| PubChem CID | 162412383 |
| Molecular Formula | C21H35NO5Si |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | benzyl N-[(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethyloxan-4-yl]carbamate |
| SMILES | CC1O[C@H](O[Si](C)(C)C(C)(C)C)C[C@@](C)(NC(=O)OCc2ccccc2)C1O |
| InChI | InChI=1S/C21H35NO5Si/c1-15-18(23)21(5,13-17(26-15)27-28(6,7)20(2,3)4)22-19(24)25-14-16-11-9-8-10-12-16/h8-12,15,17-18,23H,13-14H2,1-7H3,(H,22,24)/t15?,17-,18?,21-/m1/s1 |
| InChIKey | NHYNNOWRYVNKAT-OYMMLTSBSA-N |
| XLogP | 4.19 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|