C24H36N2O6Si — CID 56618834
[deuterio(phenyl)methyl] N-[[(3aS,4S,6S,6aS)-4-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-cyanomethyl]carbamate (PubChem CID 56618834) has the molecular formula C24H36N2O6Si and a molecular weight of 477.65 g/mol. Its IUPAC name is [deuterio(phenyl)methyl] N-[[(3aS,4S,6S,6aS)-4-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-cyanomethyl]carbamate.
| Compound Name | [deuterio(phenyl)methyl] N-[[(3aS,4S,6S,6aS)-4-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-cyanomethyl]carbamate |
|---|---|
| PubChem CID | 56618834 |
| Molecular Formula | C24H36N2O6Si |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | [deuterio(phenyl)methyl] N-[[(3aS,4S,6S,6aS)-4-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-cyanomethyl]carbamate |
| SMILES | [2H]C(OC(=O)NC(C#N)[C@@H]1O[C@H](C(O)[Si](C)(C)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C24H36N2O6Si/c1-23(2,3)33(6,7)21(27)20-19-18(31-24(4,5)32-19)17(30-20)16(13-25)26-22(28)29-14-15-11-9-8-10-12-15/h8-12,16-21,27H,14H2,1-7H3,(H,26,28)/t16?,17-,18-,19-,20-,21?/m0/s1/i14D/t14?,16?,17-,18-,19-,20-,21? |
| InChIKey | CQMAVPZWKIRZQN-SYEHJZFPSA-N |
| XLogP | 3.50 |
| TPSA | 110.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|