C21H32N2O4S — CID 134971614
tert-butyl (4S)-4-hydroxy-8a-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,2,3,4,4a,5,7,8-octahydro-1,6-naphthyridine-6-carboxylate (PubChem CID 134971614) has the molecular formula C21H32N2O4S and a molecular weight of 408.56 g/mol. Its IUPAC name is tert-butyl (4S)-4-hydroxy-8a-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,2,3,4,4a,5,7,8-octahydro-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl (4S)-4-hydroxy-8a-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,2,3,4,4a,5,7,8-octahydro-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 134971614 |
| Molecular Formula | C21H32N2O4S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | tert-butyl (4S)-4-hydroxy-8a-[[(S)-(4-methylphenyl)sulfinyl]methyl]-1,2,3,4,4a,5,7,8-octahydro-1,6-naphthyridine-6-carboxylate |
| SMILES | Cc1ccc([S@@](=O)CC23CCN(C(=O)OC(C)(C)C)CC2[C@@H](O)CCN3)cc1 |
| InChI | InChI=1S/C21H32N2O4S/c1-15-5-7-16(8-6-15)28(26)14-21-10-12-23(19(25)27-20(2,3)4)13-17(21)18(24)9-11-22-21/h5-8,17-18,22,24H,9-14H2,1-4H3/t17?,18-,21?,28-/m0/s1 |
| InChIKey | UXNVJCJEJZGAHC-NVPNGNJZSA-N |
| XLogP | 2.45 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |