C18H21NO3 — CID 134971942
(E)-2-[(1S)-2-methoxy-1-phenylethoxy]-N-phenylmethoxyethanimine (PubChem CID 134971942) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is (E)-2-[(1S)-2-methoxy-1-phenylethoxy]-N-phenylmethoxyethanimine.
| Compound Name | (E)-2-[(1S)-2-methoxy-1-phenylethoxy]-N-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 134971942 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (E)-2-[(1S)-2-methoxy-1-phenylethoxy]-N-phenylmethoxyethanimine |
| SMILES | COC[C@@H](OC/C=N/OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-20-15-18(17-10-6-3-7-11-17)21-13-12-19-22-14-16-8-4-2-5-9-16/h2-12,18H,13-15H2,1H3/b19-12+/t18-/m1/s1 |
| InChIKey | JRIAYAGDIZMJDR-LSCADSNKSA-N |
| XLogP | 3.59 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|