C23H21F3O6S — CID 134972786
[3-[(4-ethenyl-3-prop-1-en-2-ylfuran-2-yl)methyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 134972786) has the molecular formula C23H21F3O6S and a molecular weight of 482.48 g/mol. Its IUPAC name is [3-[(4-ethenyl-3-prop-1-en-2-ylfuran-2-yl)methyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [3-[(4-ethenyl-3-prop-1-en-2-ylfuran-2-yl)methyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134972786 |
| Molecular Formula | C23H21F3O6S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | [3-[(4-ethenyl-3-prop-1-en-2-ylfuran-2-yl)methyl]-5,8-dimethoxynaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | C=Cc1coc(Cc2cc3c(OC)ccc(OC)c3cc2OS(=O)(=O)C(F)(F)F)c1C(=C)C |
| InChI | InChI=1S/C23H21F3O6S/c1-6-14-12-31-21(22(14)13(2)3)10-15-9-16-17(19(30-5)8-7-18(16)29-4)11-20(15)32-33(27,28)23(24,25)26/h6-9,11-12H,1-2,10H2,3-5H3 |
| InChIKey | JSUIQNNWKAULJV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|