C13H12F6O5S2 — CID 145079782
4-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-ethenyl-1-methoxybenzene (PubChem CID 145079782) has the molecular formula C13H12F6O5S2 and a molecular weight of 426.36 g/mol. Its IUPAC name is 4-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-ethenyl-1-methoxybenzene.
| Compound Name | 4-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-ethenyl-1-methoxybenzene |
|---|---|
| PubChem CID | 145079782 |
| Molecular Formula | C13H12F6O5S2 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 4-[2,2-bis(trifluoromethylsulfonyl)ethyl]-2-ethenyl-1-methoxybenzene |
| SMILES | C=Cc1cc(CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)ccc1OC |
| InChI | InChI=1S/C13H12F6O5S2/c1-3-9-6-8(4-5-10(9)24-2)7-11(25(20,21)12(14,15)16)26(22,23)13(17,18)19/h3-6,11H,1,7H2,2H3 |
| InChIKey | VRKSVXKLIFPMKL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |