C24H37NO5Si — CID 134972885
(4R)-4-benzyl-3-[(Z,2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylhex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 134972885) has the molecular formula C24H37NO5Si and a molecular weight of 447.65 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(Z,2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylhex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(Z,2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylhex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134972885 |
| Molecular Formula | C24H37NO5Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (4R)-4-benzyl-3-[(Z,2R,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylhex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C(=C/CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H37NO5Si/c1-17(13-14-30-31(6,7)24(3,4)5)21(26)18(2)22(27)25-20(16-29-23(25)28)15-19-11-9-8-10-12-19/h8-13,18,20-21,26H,14-16H2,1-7H3/b17-13-/t18-,20-,21+/m1/s1 |
| InChIKey | WMVBMXKXWLVMKP-POZOSAPKSA-N |
| XLogP | 4.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|