About dimagnesium;3,4-dimethanidylhexane;dibromide
dimagnesium;3,4-dimethanidylhexane;dibromide (PubChem CID 134978952) has the molecular formula C8H16Br2Mg2
and a molecular weight of 320.63 g/mol. Its IUPAC name is dimagnesium;3,4-dimethanidylhexane;dibromide.
Molecular Properties
| Compound Name | dimagnesium;3,4-dimethanidylhexane;dibromide |
| PubChem CID | 134978952 |
| Molecular Formula | C8H16Br2Mg2 |
| Molecular Weight | 320.63 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | dimagnesium;3,4-dimethanidylhexane;dibromide |
| SMILES | [Br-].[Br-].[CH2-]C(CC)C([CH2-])CC.[Mg+2].[Mg+2] |
| InChI | InChI=1S/C8H16.2BrH.2Mg/c1-5-7(3)8(4)6-2;;;;/h7-8H,3-6H2,1-2H3;2*1H;;/q-2;;;2*+2/p-2 |
| InChIKey | KZOCPJQLCOJBRV-UHFFFAOYSA-L |
| XLogP | -4.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.63 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dimagnesium;3,4-dimethanidylhexane;dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimagnesium;3,4-dimethanidylhexane;dibromide?
The IUPAC name of dimagnesium;3,4-dimethanidylhexane;dibromide (CID 134978952) is dimagnesium;3,4-dimethanidylhexane;dibromide.
What is the SMILES notation for dimagnesium;3,4-dimethanidylhexane;dibromide?
The canonical SMILES for dimagnesium;3,4-dimethanidylhexane;dibromide is [Br-].[Br-].[CH2-]C(CC)C([CH2-])CC.[Mg+2].[Mg+2].
What is the InChIKey of dimagnesium;3,4-dimethanidylhexane;dibromide?
The InChIKey is KZOCPJQLCOJBRV-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H16.2BrH.2Mg/c1-5-7(3)8(4)6-2;;;;/h7-8H,3-6H2,1-2H3;2*1H;;/q-2;;;2*+2/p-2.
What are the key properties of dimagnesium;3,4-dimethanidylhexane;dibromide?
dimagnesium;3,4-dimethanidylhexane;dibromide has a molecular weight of 320.63 g/mol, XLogP of -4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimagnesium;3,4-dimethanidylhexane;dibromide is sourced from PubChem (CID 134978952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).