About butane-2-thiolate
butane-2-thiolate (PubChem CID 23432820) has the molecular formula C4H9S-
and a molecular weight of 89.18 g/mol. Its IUPAC name is butane-2-thiolate.
Molecular Properties
| Compound Name | butane-2-thiolate |
| PubChem CID | 23432820 |
| Molecular Formula | C4H9S- |
| Molecular Weight | 89.18 g/mol |
| Exact Mass | 89.04 |
| IUPAC Name | butane-2-thiolate |
| SMILES | CCC(C)[S-] |
| InChI | InChI=1S/C4H10S/c1-3-4(2)5/h4-5H,3H2,1-2H3/p-1 |
| InChIKey | LOCHFZBWPCLPAN-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 89.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze butane-2-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2-thiolate?
The IUPAC name of butane-2-thiolate (CID 23432820) is butane-2-thiolate.
What is the SMILES notation for butane-2-thiolate?
The canonical SMILES for butane-2-thiolate is CCC(C)[S-].
What is the InChIKey of butane-2-thiolate?
The InChIKey is LOCHFZBWPCLPAN-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10S/c1-3-4(2)5/h4-5H,3H2,1-2H3/p-1.
What are the key properties of butane-2-thiolate?
butane-2-thiolate has a molecular weight of 89.18 g/mol, XLogP of 1.33, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2-thiolate is sourced from PubChem (CID 23432820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).