C30H32O4 — CID 134983575
2-benzoyl-4,6-ditert-butyl-3-phenacyloxycyclohepta-2,4,6-trien-1-one (PubChem CID 134983575) has the molecular formula C30H32O4 and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-benzoyl-4,6-ditert-butyl-3-phenacyloxycyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-benzoyl-4,6-ditert-butyl-3-phenacyloxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 134983575 |
| Molecular Formula | C30H32O4 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 2-benzoyl-4,6-ditert-butyl-3-phenacyloxycyclohepta-2,4,6-trien-1-one |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(OCC(=O)c2ccccc2)c(C(=O)c2ccccc2)c(=O)c1 |
| InChI | InChI=1S/C30H32O4/c1-29(2,3)22-17-23(30(4,5)6)28(34-19-25(32)20-13-9-7-10-14-20)26(24(31)18-22)27(33)21-15-11-8-12-16-21/h7-18H,19H2,1-6H3 |
| InChIKey | JEAYLGPMTCVPHX-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |