C18H22O4 — CID 135002057
[(1R,4R)-4-[(E,1R)-1-hydroxy-3-phenylprop-2-enyl]cyclopent-2-en-1-yl] propan-2-yl carbonate (PubChem CID 135002057) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is [(1R,4R)-4-[(E,1R)-1-hydroxy-3-phenylprop-2-enyl]cyclopent-2-en-1-yl] propan-2-yl carbonate.
| Compound Name | [(1R,4R)-4-[(E,1R)-1-hydroxy-3-phenylprop-2-enyl]cyclopent-2-en-1-yl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 135002057 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(1R,4R)-4-[(E,1R)-1-hydroxy-3-phenylprop-2-enyl]cyclopent-2-en-1-yl] propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)O[C@H]1C=C[C@H]([C@H](O)/C=C/c2ccccc2)C1 |
| InChI | InChI=1S/C18H22O4/c1-13(2)21-18(20)22-16-10-9-15(12-16)17(19)11-8-14-6-4-3-5-7-14/h3-11,13,15-17,19H,12H2,1-2H3/b11-8+/t15-,16-,17+/m0/s1 |
| InChIKey | YSEUIKRTQKCWPO-CPUCUTALSA-N |
| XLogP | 3.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|