C16H26O3Si — CID 135002117
ethyl (2E)-2-[3-(methoxymethyl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate (PubChem CID 135002117) has the molecular formula C16H26O3Si and a molecular weight of 294.47 g/mol. Its IUPAC name is ethyl (2E)-2-[3-(methoxymethyl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate.
| Compound Name | ethyl (2E)-2-[3-(methoxymethyl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate |
|---|---|
| PubChem CID | 135002117 |
| Molecular Formula | C16H26O3Si |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | ethyl (2E)-2-[3-(methoxymethyl)-5-trimethylsilylcyclohepta-2,4-dien-1-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/C=C(COC)C=C([Si](C)(C)C)CC1 |
| InChI | InChI=1S/C16H26O3Si/c1-6-19-16(17)11-13-7-8-15(20(3,4)5)10-14(9-13)12-18-2/h9-11H,6-8,12H2,1-5H3/b13-11+ |
| InChIKey | SUKSDQDGSHJUMF-ACCUITESSA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|