C16H22O4 — CID 135008500
2-[2-[(2S,3R)-2-phenylmethoxyoxolan-3-yl]ethyl]-1,3-dioxolane (PubChem CID 135008500) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-[2-[(2S,3R)-2-phenylmethoxyoxolan-3-yl]ethyl]-1,3-dioxolane.
| Compound Name | 2-[2-[(2S,3R)-2-phenylmethoxyoxolan-3-yl]ethyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 135008500 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[2-[(2S,3R)-2-phenylmethoxyoxolan-3-yl]ethyl]-1,3-dioxolane |
| SMILES | c1ccc(CO[C@@H]2OCC[C@H]2CCC2OCCO2)cc1 |
| InChI | InChI=1S/C16H22O4/c1-2-4-13(5-3-1)12-20-16-14(8-9-19-16)6-7-15-17-10-11-18-15/h1-5,14-16H,6-12H2/t14-,16+/m1/s1 |
| InChIKey | JOOITJPEBXSWKS-ZBFHGGJFSA-N |
| XLogP | 2.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |