C22H47NO5Si2 — CID 135012782
methyl N-[4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)hex-2-en-2-yl]-N-ethylcarbamate (PubChem CID 135012782) has the molecular formula C22H47NO5Si2 and a molecular weight of 461.79 g/mol. Its IUPAC name is methyl N-[4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)hex-2-en-2-yl]-N-ethylcarbamate.
| Compound Name | methyl N-[4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)hex-2-en-2-yl]-N-ethylcarbamate |
|---|---|
| PubChem CID | 135012782 |
| Molecular Formula | C22H47NO5Si2 |
| Molecular Weight | 461.79 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | methyl N-[4-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethoxymethoxy)hex-2-en-2-yl]-N-ethylcarbamate |
| SMILES | CCC(C=C(COCOCC[Si](C)(C)C)N(CC)C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H47NO5Si2/c1-12-20(28-30(10,11)22(3,4)5)16-19(23(13-2)21(24)25-6)17-27-18-26-14-15-29(7,8)9/h16,20H,12-15,17-18H2,1-11H3 |
| InChIKey | ZAMPMJHWLULMOG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|