C21H40N2O5Si2 — CID 155679523
ethyl 3-[1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate (PubChem CID 155679523) has the molecular formula C21H40N2O5Si2 and a molecular weight of 456.73 g/mol. Its IUPAC name is ethyl 3-[1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate.
| Compound Name | ethyl 3-[1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 155679523 |
| Molecular Formula | C21H40N2O5Si2 |
| Molecular Weight | 456.73 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | ethyl 3-[1-[tert-butyl(dimethyl)silyl]oxy-3-oxopropyl]-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(C(CC=O)O[Si](C)(C)C(C)(C)C)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C21H40N2O5Si2/c1-10-27-20(25)18-15-17(22-23(18)16-26-13-14-29(5,6)7)19(11-12-24)28-30(8,9)21(2,3)4/h12,15,19H,10-11,13-14,16H2,1-9H3 |
| InChIKey | AQSSNUWWRUJISD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.73 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|