C20H41NO5Si2 — CID 42642875
methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxymethyl)-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 42642875) has the molecular formula C20H41NO5Si2 and a molecular weight of 431.72 g/mol. Its IUPAC name is methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxymethyl)-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxymethyl)-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 42642875 |
| Molecular Formula | C20H41NO5Si2 |
| Molecular Weight | 431.72 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-(2-trimethylsilylethoxymethoxymethyl)-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@@H](O[Si](C)(C)C(C)(C)C)C=C1COCOCC[Si](C)(C)C |
| InChI | InChI=1S/C20H41NO5Si2/c1-20(2,3)28(8,9)26-18-10-11-21(19(22)23-4)17(14-18)15-25-16-24-12-13-27(5,6)7/h14,18H,10-13,15-16H2,1-9H3/t18-/m1/s1 |
| InChIKey | YBSGOQHPEJMMFO-GOSISDBHSA-N |
| XLogP | 5.06 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.72 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|