C16H35NO6Si2 — CID 15747789
2-trimethylsilylethyl (4S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxyoxazinane-2-carboxylate (PubChem CID 15747789) has the molecular formula C16H35NO6Si2 and a molecular weight of 393.63 g/mol. Its IUPAC name is 2-trimethylsilylethyl (4S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxyoxazinane-2-carboxylate.
| Compound Name | 2-trimethylsilylethyl (4S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxyoxazinane-2-carboxylate |
|---|---|
| PubChem CID | 15747789 |
| Molecular Formula | C16H35NO6Si2 |
| Molecular Weight | 393.63 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-trimethylsilylethyl (4S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxyoxazinane-2-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1ON(C(=O)OCC[Si](C)(C)C)C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H35NO6Si2/c1-16(2,3)25(7,8)23-14-13(19)12(18)11-17(22-14)15(20)21-9-10-24(4,5)6/h12-14,18-19H,9-11H2,1-8H3/t12-,13-,14+/m0/s1 |
| InChIKey | ORILOLQLQLAIEF-MELADBBJSA-N |
| XLogP | 2.78 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|