C19H17ClO — CID 135013023
3-chloro-4-(2,2-diphenylethenyl)-3,6-dihydro-2H-pyran (PubChem CID 135013023) has the molecular formula C19H17ClO and a molecular weight of 296.80 g/mol. Its IUPAC name is 3-chloro-4-(2,2-diphenylethenyl)-3,6-dihydro-2H-pyran.
| Compound Name | 3-chloro-4-(2,2-diphenylethenyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 135013023 |
| Molecular Formula | C19H17ClO |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-chloro-4-(2,2-diphenylethenyl)-3,6-dihydro-2H-pyran |
| SMILES | ClC1COCC=C1C=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17ClO/c20-19-14-21-12-11-17(19)13-18(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-11,13,19H,12,14H2 |
| InChIKey | FRDLXZKXNINSFD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|