C18H17ClO2 — CID 162406838
2-[(Z)-2-(3-chlorophenyl)-2-phenylethenyl]-1,4-dioxane (PubChem CID 162406838) has the molecular formula C18H17ClO2 and a molecular weight of 300.78 g/mol. Its IUPAC name is 2-[(Z)-2-(3-chlorophenyl)-2-phenylethenyl]-1,4-dioxane.
| Compound Name | 2-[(Z)-2-(3-chlorophenyl)-2-phenylethenyl]-1,4-dioxane |
|---|---|
| PubChem CID | 162406838 |
| Molecular Formula | C18H17ClO2 |
| Molecular Weight | 300.78 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-[(Z)-2-(3-chlorophenyl)-2-phenylethenyl]-1,4-dioxane |
| SMILES | Clc1cccc(/C(=C\C2COCCO2)c2ccccc2)c1 |
| InChI | InChI=1S/C18H17ClO2/c19-16-8-4-7-15(11-16)18(14-5-2-1-3-6-14)12-17-13-20-9-10-21-17/h1-8,11-12,17H,9-10,13H2/b18-12- |
| InChIKey | XFNGNHMPKNMIGK-PDGQHHTCSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |