C14H9Br2NO3 — CID 135017168
5-amino-4-(3,4-dibromofuran-2-carbonyl)-2,3-dihydroinden-1-one (PubChem CID 135017168) has the molecular formula C14H9Br2NO3 and a molecular weight of 399.04 g/mol. Its IUPAC name is 5-amino-4-(3,4-dibromofuran-2-carbonyl)-2,3-dihydroinden-1-one.
| Compound Name | 5-amino-4-(3,4-dibromofuran-2-carbonyl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 135017168 |
| Molecular Formula | C14H9Br2NO3 |
| Molecular Weight | 399.04 g/mol |
| Exact Mass | 396.89 |
| IUPAC Name | 5-amino-4-(3,4-dibromofuran-2-carbonyl)-2,3-dihydroinden-1-one |
| SMILES | Nc1ccc2c(c1C(=O)c1occ(Br)c1Br)CCC2=O |
| InChI | InChI=1S/C14H9Br2NO3/c15-8-5-20-14(12(8)16)13(19)11-7-2-4-10(18)6(7)1-3-9(11)17/h1,3,5H,2,4,17H2 |
| InChIKey | FSXIWNABYGMLLZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|