C30H35NO7S — CID 135018376
[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methyl methanesulfonate (PubChem CID 135018376) has the molecular formula C30H35NO7S and a molecular weight of 553.68 g/mol. Its IUPAC name is [4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methyl methanesulfonate.
| Compound Name | [4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 135018376 |
| Molecular Formula | C30H35NO7S |
| Molecular Weight | 553.68 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | [4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1CC2C(OCc3ccccc3)C(OCc3ccccc3)C(COCc3ccccc3)N2O1 |
| InChI | InChI=1S/C30H35NO7S/c1-39(32,33)37-21-26-17-27-29(35-19-24-13-7-3-8-14-24)30(36-20-25-15-9-4-10-16-25)28(31(27)38-26)22-34-18-23-11-5-2-6-12-23/h2-16,26-30H,17-22H2,1H3 |
| InChIKey | ZIUHLVYVUUMWFE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.68 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|