C18H30O2Si — CID 135020768
(3E)-1-phenyl-3-(trimethylsilylmethylidene)octane-1,4-diol (PubChem CID 135020768) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (3E)-1-phenyl-3-(trimethylsilylmethylidene)octane-1,4-diol.
| Compound Name | (3E)-1-phenyl-3-(trimethylsilylmethylidene)octane-1,4-diol |
|---|---|
| PubChem CID | 135020768 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (3E)-1-phenyl-3-(trimethylsilylmethylidene)octane-1,4-diol |
| SMILES | CCCCC(O)/C(=C/[Si](C)(C)C)CC(O)c1ccccc1 |
| InChI | InChI=1S/C18H30O2Si/c1-5-6-12-17(19)16(14-21(2,3)4)13-18(20)15-10-8-7-9-11-15/h7-11,14,17-20H,5-6,12-13H2,1-4H3/b16-14+ |
| InChIKey | ADCQAYBOUPSDHZ-JQIJEIRASA-N |
| XLogP | 4.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|