C36H51NO7Si — CID 135023341
(2S,3R,6S,9R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,9-dimethyl-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-6-phenylmethoxydodec-11-ene-1,8-dione (PubChem CID 135023341) has the molecular formula C36H51NO7Si and a molecular weight of 637.89 g/mol. Its IUPAC name is (2S,3R,6S,9R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,9-dimethyl-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-6-phenylmethoxydodec-11-ene-1,8-dione.
| Compound Name | (2S,3R,6S,9R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,9-dimethyl-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-6-phenylmethoxydodec-11-ene-1,8-dione |
|---|---|
| PubChem CID | 135023341 |
| Molecular Formula | C36H51NO7Si |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.34 |
| IUPAC Name | (2S,3R,6S,9R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,9-dimethyl-1-[(4S)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-6-phenylmethoxydodec-11-ene-1,8-dione |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C[C@H](CC[C@@H](O)[C@H](C)C(=O)N1C(=O)OC[C@@H]1c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C36H51NO7Si/c1-9-33(44-45(7,8)36(4,5)6)25(2)32(39)22-29(42-23-27-16-12-10-13-17-27)20-21-31(38)26(3)34(40)37-30(24-43-35(37)41)28-18-14-11-15-19-28/h9-19,25-26,29-31,33,38H,1,20-24H2,2-8H3/t25-,26-,29-,30+,31+,33-/m0/s1 |
| InChIKey | CWDZAXQEQYMMIT-BPAHKXKNSA-N |
| XLogP | 7.24 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|