C32H38N2O3 — CID 135024481
(2S)-2-(dibenzylamino)-1-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,3-dimethyloxiran-2-yl]-3-phenylpropan-1-ol (PubChem CID 135024481) has the molecular formula C32H38N2O3 and a molecular weight of 498.67 g/mol. Its IUPAC name is (2S)-2-(dibenzylamino)-1-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,3-dimethyloxiran-2-yl]-3-phenylpropan-1-ol.
| Compound Name | (2S)-2-(dibenzylamino)-1-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,3-dimethyloxiran-2-yl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 135024481 |
| Molecular Formula | C32H38N2O3 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | (2S)-2-(dibenzylamino)-1-[2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3,3-dimethyloxiran-2-yl]-3-phenylpropan-1-ol |
| SMILES | CC1(C)COC(C2(C(O)[C@H](Cc3ccccc3)N(Cc3ccccc3)Cc3ccccc3)OC2(C)C)=N1 |
| InChI | InChI=1S/C32H38N2O3/c1-30(2)23-36-29(33-30)32(31(3,4)37-32)28(35)27(20-24-14-8-5-9-15-24)34(21-25-16-10-6-11-17-25)22-26-18-12-7-13-19-26/h5-19,27-28,35H,20-23H2,1-4H3/t27-,28?,32?/m0/s1 |
| InChIKey | RGPIPEPQDKBESM-UNMCHZSKSA-N |
| XLogP | 5.42 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|