C27H31NO2 — CID 10476184
(2S,3S)-2-[(1S)-1-(dibenzylamino)-2-phenylethyl]-3-methyloxolan-3-ol (PubChem CID 10476184) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is (2S,3S)-2-[(1S)-1-(dibenzylamino)-2-phenylethyl]-3-methyloxolan-3-ol.
| Compound Name | (2S,3S)-2-[(1S)-1-(dibenzylamino)-2-phenylethyl]-3-methyloxolan-3-ol |
|---|---|
| PubChem CID | 10476184 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (2S,3S)-2-[(1S)-1-(dibenzylamino)-2-phenylethyl]-3-methyloxolan-3-ol |
| SMILES | C[C@]1(O)CCO[C@H]1[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO2/c1-27(29)17-18-30-26(27)25(19-22-11-5-2-6-12-22)28(20-23-13-7-3-8-14-23)21-24-15-9-4-10-16-24/h2-16,25-26,29H,17-21H2,1H3/t25-,26-,27-/m0/s1 |
| InChIKey | KGFUGLCOBYTJDU-QKDODKLFSA-N |
| XLogP | 4.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |