C19H12N4 — CID 135026654
3-phenyl-8-(2-phenylethynyl)-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 135026654) has the molecular formula C19H12N4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-phenyl-8-(2-phenylethynyl)-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-phenyl-8-(2-phenylethynyl)-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 135026654 |
| Molecular Formula | C19H12N4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 3-phenyl-8-(2-phenylethynyl)-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | C(#Cc1nccn2c(-c3ccccc3)nnc12)c1ccccc1 |
| InChI | InChI=1S/C19H12N4/c1-3-7-15(8-4-1)11-12-17-19-22-21-18(23(19)14-13-20-17)16-9-5-2-6-10-16/h1-10,13-14H |
| InChIKey | GOZDAGBJWSNYKQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|