C30H50O5Si2 — CID 135027702
(E,5R,6R,10R)-11-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-[(4-methoxyphenyl)methoxy]-6,10-dimethyl-1-trimethylsilylundec-8-en-1-yn-3-one (PubChem CID 135027702) has the molecular formula C30H50O5Si2 and a molecular weight of 546.90 g/mol. Its IUPAC name is (E,5R,6R,10R)-11-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-[(4-methoxyphenyl)methoxy]-6,10-dimethyl-1-trimethylsilylundec-8-en-1-yn-3-one.
| Compound Name | (E,5R,6R,10R)-11-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-[(4-methoxyphenyl)methoxy]-6,10-dimethyl-1-trimethylsilylundec-8-en-1-yn-3-one |
|---|---|
| PubChem CID | 135027702 |
| Molecular Formula | C30H50O5Si2 |
| Molecular Weight | 546.90 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | (E,5R,6R,10R)-11-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6-[(4-methoxyphenyl)methoxy]-6,10-dimethyl-1-trimethylsilylundec-8-en-1-yn-3-one |
| SMILES | COc1ccc(CO[C@](C)(C/C=C/[C@@H](C)CO[Si](C)(C)C(C)(C)C)[C@H](O)CC(=O)C#C[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C30H50O5Si2/c1-24(22-35-37(10,11)29(2,3)4)13-12-19-30(5,28(32)21-26(31)18-20-36(7,8)9)34-23-25-14-16-27(33-6)17-15-25/h12-17,24,28,32H,19,21-23H2,1-11H3/b13-12+/t24-,28-,30-/m1/s1 |
| InChIKey | CNWOBUIMHHBJMY-JDFUAEEQSA-N |
| XLogP | 6.78 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.90 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|