C18H20N2O4 — CID 135031372
methyl 8-cyano-3-(1,3-dioxoisoindol-2-yl)octanoate (PubChem CID 135031372) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is methyl 8-cyano-3-(1,3-dioxoisoindol-2-yl)octanoate.
| Compound Name | methyl 8-cyano-3-(1,3-dioxoisoindol-2-yl)octanoate |
|---|---|
| PubChem CID | 135031372 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 8-cyano-3-(1,3-dioxoisoindol-2-yl)octanoate |
| SMILES | COC(=O)CC(CCCCCC#N)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H20N2O4/c1-24-16(21)12-13(8-4-2-3-7-11-19)20-17(22)14-9-5-6-10-15(14)18(20)23/h5-6,9-10,13H,2-4,7-8,12H2,1H3 |
| InChIKey | PTVSFBIXHWZMNS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|