C16H24OS — CID 135032116
(1R,2S)-1-cyclopropyl-2-phenylsulfanylheptan-1-ol (PubChem CID 135032116) has the molecular formula C16H24OS and a molecular weight of 264.43 g/mol. Its IUPAC name is (1R,2S)-1-cyclopropyl-2-phenylsulfanylheptan-1-ol.
| Compound Name | (1R,2S)-1-cyclopropyl-2-phenylsulfanylheptan-1-ol |
|---|---|
| PubChem CID | 135032116 |
| Molecular Formula | C16H24OS |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (1R,2S)-1-cyclopropyl-2-phenylsulfanylheptan-1-ol |
| SMILES | CCCCC[C@H](Sc1ccccc1)[C@H](O)C1CC1 |
| InChI | InChI=1S/C16H24OS/c1-2-3-5-10-15(16(17)13-11-12-13)18-14-8-6-4-7-9-14/h4,6-9,13,15-17H,2-3,5,10-12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | CWURDDBOPHXWLN-JKSUJKDBSA-N |
| XLogP | 4.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|