C12H21BrO3 — CID 135037243
(6S)-4-bromo-2-ethyl-6-[(4R)-2-ethyl-1,3-dioxolan-4-yl]oxane (PubChem CID 135037243) has the molecular formula C12H21BrO3 and a molecular weight of 293.20 g/mol. Its IUPAC name is (6S)-4-bromo-2-ethyl-6-[(4R)-2-ethyl-1,3-dioxolan-4-yl]oxane.
| Compound Name | (6S)-4-bromo-2-ethyl-6-[(4R)-2-ethyl-1,3-dioxolan-4-yl]oxane |
|---|---|
| PubChem CID | 135037243 |
| Molecular Formula | C12H21BrO3 |
| Molecular Weight | 293.20 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (6S)-4-bromo-2-ethyl-6-[(4R)-2-ethyl-1,3-dioxolan-4-yl]oxane |
| SMILES | CCC1CC(Br)C[C@@H]([C@H]2COC(CC)O2)O1 |
| InChI | InChI=1S/C12H21BrO3/c1-3-9-5-8(13)6-10(15-9)11-7-14-12(4-2)16-11/h8-12H,3-7H2,1-2H3/t8?,9?,10-,11+,12?/m0/s1 |
| InChIKey | GAIWOHDOJMBBCA-RCYCPDCESA-N |
| XLogP | 2.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.20 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|